C9H9ClO2 — CID 167276538
5-chloro-6-methyl-1,3-dihydro-2-benzofuran-1-ol (PubChem CID 167276538) has the molecular formula C9H9ClO2 and a molecular weight of 184.62 g/mol. Its IUPAC name is 5-chloro-6-methyl-1,3-dihydro-2-benzofuran-1-ol.
| Compound Name | 5-chloro-6-methyl-1,3-dihydro-2-benzofuran-1-ol |
|---|---|
| PubChem CID | 167276538 |
| Molecular Formula | C9H9ClO2 |
| Molecular Weight | 184.62 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | 5-chloro-6-methyl-1,3-dihydro-2-benzofuran-1-ol |
| SMILES | Cc1cc2c(cc1Cl)COC2O |
| InChI | InChI=1S/C9H9ClO2/c1-5-2-7-6(3-8(5)10)4-12-9(7)11/h2-3,9,11H,4H2,1H3 |
| InChIKey | ZKQQRNHFEJAOAF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.62 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |