C24H29N3O2 — CID 167287109
2,3-dimethoxy-N-[(3R)-1-(2-methylcyclopropyl)piperidin-3-yl]acridin-9-amine (PubChem CID 167287109) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 2,3-dimethoxy-N-[(3R)-1-(2-methylcyclopropyl)piperidin-3-yl]acridin-9-amine.
| Compound Name | 2,3-dimethoxy-N-[(3R)-1-(2-methylcyclopropyl)piperidin-3-yl]acridin-9-amine |
|---|---|
| PubChem CID | 167287109 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 2,3-dimethoxy-N-[(3R)-1-(2-methylcyclopropyl)piperidin-3-yl]acridin-9-amine |
| SMILES | COc1cc2nc3ccccc3c(N[C@@H]3CCCN(C4CC4C)C3)c2cc1OC |
| InChI | InChI=1S/C24H29N3O2/c1-15-11-21(15)27-10-6-7-16(14-27)25-24-17-8-4-5-9-19(17)26-20-13-23(29-3)22(28-2)12-18(20)24/h4-5,8-9,12-13,15-16,21H,6-7,10-11,14H2,1-3H3,(H,25,26)/t15?,16-,21?/m1/s1 |
| InChIKey | CZQGRCPARGCMSM-ZGOJQLDESA-N |
| XLogP | 4.69 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|