C7H13ClN2O2 — CID 167287153
amino-[[(1E)-3-chloro-1-methoxybuta-1,3-dienyl]-methylamino]methanol (PubChem CID 167287153) has the molecular formula C7H13ClN2O2 and a molecular weight of 192.65 g/mol. Its IUPAC name is amino-[[(1E)-3-chloro-1-methoxybuta-1,3-dienyl]-methylamino]methanol.
| Compound Name | amino-[[(1E)-3-chloro-1-methoxybuta-1,3-dienyl]-methylamino]methanol |
|---|---|
| PubChem CID | 167287153 |
| Molecular Formula | C7H13ClN2O2 |
| Molecular Weight | 192.65 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | amino-[[(1E)-3-chloro-1-methoxybuta-1,3-dienyl]-methylamino]methanol |
| SMILES | C=C(Cl)/C=C(/OC)N(C)C(N)O |
| InChI | InChI=1S/C7H13ClN2O2/c1-5(8)4-6(12-3)10(2)7(9)11/h4,7,11H,1,9H2,2-3H3/b6-4+ |
| InChIKey | LRKMFWGIHCZWOH-GQCTYLIASA-N |
| XLogP | 0.39 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.65 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|