About (Z)-2,5-dimethyl-6-methyliminohept-2-ene-1-thiol
(Z)-2,5-dimethyl-6-methyliminohept-2-ene-1-thiol (PubChem CID 167292732) has the molecular formula C10H19NS
and a molecular weight of 185.34 g/mol. Its IUPAC name is (Z)-2,5-dimethyl-6-methyliminohept-2-ene-1-thiol.
Molecular Properties
| Compound Name | (Z)-2,5-dimethyl-6-methyliminohept-2-ene-1-thiol |
| PubChem CID | 167292732 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (Z)-2,5-dimethyl-6-methyliminohept-2-ene-1-thiol |
| SMILES | C/N=C(\C)C(C)C/C=C(/C)CS |
| InChI | InChI=1S/C10H19NS/c1-8(7-12)5-6-9(2)10(3)11-4/h5,9,12H,6-7H2,1-4H3/b8-5-,11-10+ |
| InChIKey | QCISEAFRKGJUDU-VPDIDQSWSA-N |
| XLogP | 2.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2,5-dimethyl-6-methyliminohept-2-ene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,5-dimethyl-6-methyliminohept-2-ene-1-thiol?
The IUPAC name of (Z)-2,5-dimethyl-6-methyliminohept-2-ene-1-thiol (CID 167292732) is (Z)-2,5-dimethyl-6-methyliminohept-2-ene-1-thiol.
What is the SMILES notation for (Z)-2,5-dimethyl-6-methyliminohept-2-ene-1-thiol?
The canonical SMILES for (Z)-2,5-dimethyl-6-methyliminohept-2-ene-1-thiol is C/N=C(\C)C(C)C/C=C(/C)CS.
What is the InChIKey of (Z)-2,5-dimethyl-6-methyliminohept-2-ene-1-thiol?
The InChIKey is QCISEAFRKGJUDU-VPDIDQSWSA-N. The full InChI is InChI=1S/C10H19NS/c1-8(7-12)5-6-9(2)10(3)11-4/h5,9,12H,6-7H2,1-4H3/b8-5-,11-10+.
What are the key properties of (Z)-2,5-dimethyl-6-methyliminohept-2-ene-1-thiol?
(Z)-2,5-dimethyl-6-methyliminohept-2-ene-1-thiol has a molecular weight of 185.34 g/mol, XLogP of 2.98, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,5-dimethyl-6-methyliminohept-2-ene-1-thiol is sourced from PubChem (CID 167292732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).