C10H19NS — CID 167292732
(Z)-2,5-dimethyl-6-methyliminohept-2-ene-1-thiol (PubChem CID 167292732) has the molecular formula C10H19NS and a molecular weight of 185.34 g/mol. Its IUPAC name is (Z)-2,5-dimethyl-6-methyliminohept-2-ene-1-thiol.
| Compound Name | (Z)-2,5-dimethyl-6-methyliminohept-2-ene-1-thiol |
|---|---|
| PubChem CID | 167292732 |
| Molecular Formula | C10H19NS |
| Molecular Weight | 185.34 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (Z)-2,5-dimethyl-6-methyliminohept-2-ene-1-thiol |
| SMILES | C/N=C(\C)C(C)C/C=C(/C)CS |
| InChI | InChI=1S/C10H19NS/c1-8(7-12)5-6-9(2)10(3)11-4/h5,9,12H,6-7H2,1-4H3/b8-5-,11-10+ |
| InChIKey | QCISEAFRKGJUDU-VPDIDQSWSA-N |
| XLogP | 2.98 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|