C15H14BNO2 — CID 167433038
2-(4-methylphenyl)-5-phenyl-6H-1,3,4,2-dioxazaborinine (PubChem CID 167433038) has the molecular formula C15H14BNO2 and a molecular weight of 251.09 g/mol. Its IUPAC name is 2-(4-methylphenyl)-5-phenyl-6H-1,3,4,2-dioxazaborinine.
| Compound Name | 2-(4-methylphenyl)-5-phenyl-6H-1,3,4,2-dioxazaborinine |
|---|---|
| PubChem CID | 167433038 |
| Molecular Formula | C15H14BNO2 |
| Molecular Weight | 251.09 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 2-(4-methylphenyl)-5-phenyl-6H-1,3,4,2-dioxazaborinine |
| SMILES | Cc1ccc(B2OCC(c3ccccc3)=NO2)cc1 |
| InChI | InChI=1S/C15H14BNO2/c1-12-7-9-14(10-8-12)16-18-11-15(17-19-16)13-5-3-2-4-6-13/h2-10H,11H2,1H3 |
| InChIKey | UWXNROZCUGIZSN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.09 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|