C10H8ClNO3S — CID 167434977
2-chloro-4-(4-methylphenyl)sulfonyl-1,3-oxazole (PubChem CID 167434977) has the molecular formula C10H8ClNO3S and a molecular weight of 257.70 g/mol. Its IUPAC name is 2-chloro-4-(4-methylphenyl)sulfonyl-1,3-oxazole.
| Compound Name | 2-chloro-4-(4-methylphenyl)sulfonyl-1,3-oxazole |
|---|---|
| PubChem CID | 167434977 |
| Molecular Formula | C10H8ClNO3S |
| Molecular Weight | 257.70 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 2-chloro-4-(4-methylphenyl)sulfonyl-1,3-oxazole |
| SMILES | Cc1ccc(S(=O)(=O)c2coc(Cl)n2)cc1 |
| InChI | InChI=1S/C10H8ClNO3S/c1-7-2-4-8(5-3-7)16(13,14)9-6-15-10(11)12-9/h2-6H,1H3 |
| InChIKey | AZCNUOMLNSYDGD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.70 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |