C23H26N4O4 — CID 167450952
N-[(E)-(3,5-dimethoxyphenyl)methylideneamino]methanamine;6-(4-ethoxyphenyl)pyrazine-2-carbaldehyde (PubChem CID 167450952) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is N-[(E)-(3,5-dimethoxyphenyl)methylideneamino]methanamine;6-(4-ethoxyphenyl)pyrazine-2-carbaldehyde.
| Compound Name | N-[(E)-(3,5-dimethoxyphenyl)methylideneamino]methanamine;6-(4-ethoxyphenyl)pyrazine-2-carbaldehyde |
|---|---|
| PubChem CID | 167450952 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | N-[(E)-(3,5-dimethoxyphenyl)methylideneamino]methanamine;6-(4-ethoxyphenyl)pyrazine-2-carbaldehyde |
| SMILES | CCOc1ccc(-c2cncc(C=O)n2)cc1.CN/N=C/c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C13H12N2O2.C10H14N2O2/c1-2-17-12-5-3-10(4-6-12)13-8-14-7-11(9-16)15-13;1-11-12-7-8-4-9(13-2)6-10(5-8)14-3/h3-9H,2H2,1H3;4-7,11H,1-3H3/b;12-7+ |
| InChIKey | KZCKUAABXXNLJK-FLDSLJMSSA-N |
| XLogP | 3.61 |
| TPSA | 94.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|