C28H37BN4O4 — CID 167458604
7-[[5-(4-cyclopropyl-4-hydroxypiperidin-1-yl)-2-pyridinyl]amino]-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-isoindol-1-one (PubChem CID 167458604) has the molecular formula C28H37BN4O4 and a molecular weight of 504.44 g/mol. Its IUPAC name is 7-[[5-(4-cyclopropyl-4-hydroxypiperidin-1-yl)-2-pyridinyl]amino]-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-isoindol-1-one.
| Compound Name | 7-[[5-(4-cyclopropyl-4-hydroxypiperidin-1-yl)-2-pyridinyl]amino]-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 167458604 |
| Molecular Formula | C28H37BN4O4 |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 504.29 |
| IUPAC Name | 7-[[5-(4-cyclopropyl-4-hydroxypiperidin-1-yl)-2-pyridinyl]amino]-2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-isoindol-1-one |
| SMILES | CN1Cc2c(B3OC(C)(C)C(C)(C)O3)ccc(Nc3ccc(N4CCC(O)(C5CC5)CC4)cn3)c2C1=O |
| InChI | InChI=1S/C28H37BN4O4/c1-26(2)27(3,4)37-29(36-26)21-9-10-22(24-20(21)17-32(5)25(24)34)31-23-11-8-19(16-30-23)33-14-12-28(35,13-15-33)18-6-7-18/h8-11,16,18,35H,6-7,12-15,17H2,1-5H3,(H,30,31) |
| InChIKey | ZTUGMMHGMLSOTC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|