C30H34ClN5OS — CID 16747157
1-[4-[5-chloro-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]-2-imidazo[4,5-b]pyridin-3-ylethanone (PubChem CID 16747157) has the molecular formula C30H34ClN5OS and a molecular weight of 548.16 g/mol. Its IUPAC name is 1-[4-[5-chloro-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]-2-imidazo[4,5-b]pyridin-3-ylethanone.
| Compound Name | 1-[4-[5-chloro-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]-2-imidazo[4,5-b]pyridin-3-ylethanone |
|---|---|
| PubChem CID | 16747157 |
| Molecular Formula | C30H34ClN5OS |
| Molecular Weight | 548.16 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | 1-[4-[5-chloro-4-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-1,3-thiazol-2-yl]piperidin-1-yl]-2-imidazo[4,5-b]pyridin-3-ylethanone |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3nc(C4CCN(C(=O)Cn5cnc6cccnc65)CC4)sc3Cl)ccc21 |
| InChI | InChI=1S/C30H34ClN5OS/c1-29(2)11-12-30(3,4)22-16-20(7-8-21(22)29)25-26(31)38-28(34-25)19-9-14-35(15-10-19)24(37)17-36-18-33-23-6-5-13-32-27(23)36/h5-8,13,16,18-19H,9-12,14-15,17H2,1-4H3 |
| InChIKey | CCBNGOJCAZEUBW-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.16 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |