C32H49FN2 — CID 167492995
N-[(E)-4-[[(2E,4Z)-1-[4-cyclopropyl-2-(1-fluoroethyl)phenyl]-2-methylhepta-2,4-dienylidene]amino]but-2-en-2-yl]-2-methyloctan-4-amine (PubChem CID 167492995) has the molecular formula C32H49FN2 and a molecular weight of 480.76 g/mol. Its IUPAC name is N-[(E)-4-[[(2E,4Z)-1-[4-cyclopropyl-2-(1-fluoroethyl)phenyl]-2-methylhepta-2,4-dienylidene]amino]but-2-en-2-yl]-2-methyloctan-4-amine.
| Compound Name | N-[(E)-4-[[(2E,4Z)-1-[4-cyclopropyl-2-(1-fluoroethyl)phenyl]-2-methylhepta-2,4-dienylidene]amino]but-2-en-2-yl]-2-methyloctan-4-amine |
|---|---|
| PubChem CID | 167492995 |
| Molecular Formula | C32H49FN2 |
| Molecular Weight | 480.76 g/mol |
| Exact Mass | 480.39 |
| IUPAC Name | N-[(E)-4-[[(2E,4Z)-1-[4-cyclopropyl-2-(1-fluoroethyl)phenyl]-2-methylhepta-2,4-dienylidene]amino]but-2-en-2-yl]-2-methyloctan-4-amine |
| SMILES | CC/C=C\C=C(C)\C(=N/C/C=C(\C)NC(CCCC)CC(C)C)c1ccc(C2CC2)cc1C(C)F |
| InChI | InChI=1S/C32H49FN2/c1-8-10-12-13-24(5)32(30-18-17-28(27-15-16-27)22-31(30)26(7)33)34-20-19-25(6)35-29(14-11-9-2)21-23(3)4/h10,12-13,17-19,22-23,26-27,29,35H,8-9,11,14-16,20-21H2,1-7H3/b12-10-,24-13+,25-19+,34-32+ |
| InChIKey | PPXNAWIAVMXEMC-VPMNCFQRSA-N |
| XLogP | 9.39 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.76 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|