C28H34N2O4S — CID 167493625
CID 167493625 (PubChem CID 167493625) has the molecular formula C28H34N2O4S and a molecular weight of 494.66 g/mol.
| Compound Name | CID 167493625 |
|---|---|
| PubChem CID | 167493625 |
| Molecular Formula | C28H34N2O4S |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | — |
| SMILES | CC(=O)c1ccc2c(c1)C1(CCC3(CC3)CC1)CN2C(=O)c1cccc(S(=O)(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C28H34N2O4S/c1-19(31)20-8-9-24-23(17-20)28(14-12-27(10-11-27)13-15-28)18-30(24)25(32)21-6-5-7-22(16-21)35(33,34)29-26(2,3)4/h5-9,16-17,29H,10-15,18H2,1-4H3 |
| InChIKey | FJEOQQUUDNKWRR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |