C27H32N2O3S — CID 167493928
CID 167493928 (PubChem CID 167493928) has the molecular formula C27H32N2O3S and a molecular weight of 464.63 g/mol.
| Compound Name | CID 167493928 |
|---|---|
| PubChem CID | 167493928 |
| Molecular Formula | C27H32N2O3S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c(c1)C1(CCC3(CC3)CC1)CN2C(=O)c1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C27H32N2O3S/c1-20-7-8-24-23(17-20)27(13-11-26(9-10-26)12-14-27)19-29(24)25(30)21-5-4-6-22(18-21)33(31,32)28-15-2-3-16-28/h4-8,17-18H,2-3,9-16,19H2,1H3 |
| InChIKey | MTQIYLPLIHIGNR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |