About CID 167494089
CID 167494089 (PubChem CID 167494089) has the molecular formula C28H34N2O3S
and a molecular weight of 478.66 g/mol.
Molecular Properties
| Compound Name | CID 167494089 |
| PubChem CID | 167494089 |
| Molecular Formula | C28H34N2O3S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.23 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c(c1)C1(CCC3(CC3)CC1)CN2C(=O)c1cccc(S(=O)(=O)N2CCC2(C)C)c1 |
| InChI | InChI=1S/C28H34N2O3S/c1-20-7-8-24-23(17-20)28(13-11-27(9-10-27)12-14-28)19-29(24)25(31)21-5-4-6-22(18-21)34(32,33)30-16-15-26(30,2)3/h4-8,17-18H,9-16,19H2,1-3H3 |
| InChIKey | VBLCNTGRWNEMCD-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 167494089 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167494089?
The IUPAC name of CID 167494089 (CID 167494089) is not available.
What is the SMILES notation for CID 167494089?
The canonical SMILES for CID 167494089 is Cc1ccc2c(c1)C1(CCC3(CC3)CC1)CN2C(=O)c1cccc(S(=O)(=O)N2CCC2(C)C)c1.
What is the InChIKey of CID 167494089?
The InChIKey is VBLCNTGRWNEMCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H34N2O3S/c1-20-7-8-24-23(17-20)28(13-11-27(9-10-27)12-14-28)19-29(24)25(31)21-5-4-6-22(18-21)34(32,33)30-16-15-26(30,2)3/h4-8,17-18H,9-16,19H2,1-3H3.
What are the key properties of CID 167494089?
CID 167494089 has a molecular weight of 478.66 g/mol, XLogP of 5.42, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167494089 is sourced from PubChem (CID 167494089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).