C28H37N3O3S2 — CID 167493724
CID 167493724 (PubChem CID 167493724) has the molecular formula C28H37N3O3S2 and a molecular weight of 527.76 g/mol.
| Compound Name | CID 167493724 |
|---|---|
| PubChem CID | 167493724 |
| Molecular Formula | C28H37N3O3S2 |
| Molecular Weight | 527.76 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | — |
| SMILES | CCC(CC)NS(=O)(=O)c1cccc(C(=O)N2CC3(CCC4(CC4)CC3)c3cc(NSC)ccc32)c1 |
| InChI | InChI=1S/C28H37N3O3S2/c1-4-21(5-2)30-36(33,34)23-8-6-7-20(17-23)26(32)31-19-28(15-13-27(11-12-27)14-16-28)24-18-22(29-35-3)9-10-25(24)31/h6-10,17-18,21,29-30H,4-5,11-16,19H2,1-3H3 |
| InChIKey | UFVABJOGVPTLST-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.76 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|