C23H25ClN2O5S2 — CID 167493685
CID 167493685 (PubChem CID 167493685) has the molecular formula C23H25ClN2O5S2 and a molecular weight of 509.05 g/mol.
| Compound Name | CID 167493685 |
|---|---|
| PubChem CID | 167493685 |
| Molecular Formula | C23H25ClN2O5S2 |
| Molecular Weight | 509.05 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | — |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)C1(CCC3(CC3)CC1)CN2C(=O)c1cccc(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C23H25ClN2O5S2/c1-32(28,29)25-17-5-6-20-19(14-17)23(11-9-22(7-8-22)10-12-23)15-26(20)21(27)16-3-2-4-18(13-16)33(24,30)31/h2-6,13-14,25H,7-12,15H2,1H3 |
| InChIKey | GNLKCUKJZXIKGF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.05 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |