C24H27ClN2O6S2 — CID 167493686
CID 167493686 (PubChem CID 167493686) has the molecular formula C24H27ClN2O6S2 and a molecular weight of 539.08 g/mol.
| Compound Name | CID 167493686 |
|---|---|
| PubChem CID | 167493686 |
| Molecular Formula | C24H27ClN2O6S2 |
| Molecular Weight | 539.08 g/mol |
| Exact Mass | 538.10 |
| IUPAC Name | — |
| SMILES | COc1ccc(C(=O)N2CC3(CCC4(CC4)CC3)c3cc(NS(C)(=O)=O)ccc32)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C24H27ClN2O6S2/c1-33-20-6-3-16(13-21(20)35(25,31)32)22(28)27-15-24(11-9-23(7-8-23)10-12-24)18-14-17(4-5-19(18)27)26-34(2,29)30/h3-6,13-14,26H,7-12,15H2,1-2H3 |
| InChIKey | YCSPFIQYNFCQIH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.08 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |