C29H36N2O4S — CID 167494190
CID 167494190 (PubChem CID 167494190) has the molecular formula C29H36N2O4S and a molecular weight of 508.68 g/mol.
| Compound Name | CID 167494190 |
|---|---|
| PubChem CID | 167494190 |
| Molecular Formula | C29H36N2O4S |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | — |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)C1(CCC3(CC3)CC1)CN2C(=O)c1cccc([C@H](O)CC2CCC2)c1 |
| InChI | InChI=1S/C29H36N2O4S/c1-36(34,35)30-23-8-9-25-24(18-23)29(14-12-28(10-11-28)13-15-29)19-31(25)27(33)22-7-3-6-21(17-22)26(32)16-20-4-2-5-20/h3,6-9,17-18,20,26,30,32H,2,4-5,10-16,19H2,1H3/t26-/m1/s1 |
| InChIKey | HMAJVUKNHIYKQQ-AREMUKBSSA-N |
| XLogP | 5.53 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |