C29H41N3O5S2 — CID 167493617
CID 167493617 (PubChem CID 167493617) has the molecular formula C29H41N3O5S2 and a molecular weight of 575.80 g/mol.
| Compound Name | CID 167493617 |
|---|---|
| PubChem CID | 167493617 |
| Molecular Formula | C29H41N3O5S2 |
| Molecular Weight | 575.80 g/mol |
| Exact Mass | 575.25 |
| IUPAC Name | — |
| SMILES | CC1CCC(NS(=O)(=O)c2cccc(C(=O)N3CC4(CCC5(CC5)CC4)c4cc(NS(C)(=O)=O)ccc43)c2)C1.[H][H].[H][H] |
| InChI | InChI=1S/C29H37N3O5S2.2H2/c1-20-6-7-22(16-20)31-39(36,37)24-5-3-4-21(17-24)27(33)32-19-29(14-12-28(10-11-28)13-15-29)25-18-23(8-9-26(25)32)30-38(2,34)35;;/h3-5,8-9,17-18,20,22,30-31H,6-7,10-16,19H2,1-2H3;2*1H |
| InChIKey | AVOXXLZJPVYWNV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.80 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |