C28H37N3O5S2 — CID 167493484
CID 167493484 (PubChem CID 167493484) has the molecular formula C28H37N3O5S2 and a molecular weight of 559.75 g/mol.
| Compound Name | CID 167493484 |
|---|---|
| PubChem CID | 167493484 |
| Molecular Formula | C28H37N3O5S2 |
| Molecular Weight | 559.75 g/mol |
| Exact Mass | 559.22 |
| IUPAC Name | — |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)C1(CCC3(CC3)CC1)CN2C(=O)c1cccc(S(=O)(=O)N2CCCCC2)c1.[H][H] |
| InChI | InChI=1S/C28H35N3O5S2.H2/c1-37(33,34)29-22-8-9-25-24(19-22)28(14-12-27(10-11-27)13-15-28)20-31(25)26(32)21-6-5-7-23(18-21)38(35,36)30-16-3-2-4-17-30;/h5-9,18-19,29H,2-4,10-17,20H2,1H3;1H |
| InChIKey | QPKUSIXCQSDKBN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.75 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |