C28H36N2O5S2 — CID 167493507
CID 167493507 (PubChem CID 167493507) has the molecular formula C28H36N2O5S2 and a molecular weight of 544.74 g/mol.
| Compound Name | CID 167493507 |
|---|---|
| PubChem CID | 167493507 |
| Molecular Formula | C28H36N2O5S2 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | — |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)C1(CCC3(CC3)CC1)CN2C(=O)c1cccc(S(=O)(=O)C2CCCC2)c1.[H][H] |
| InChI | InChI=1S/C28H34N2O5S2.H2/c1-36(32,33)29-21-9-10-25-24(18-21)28(15-13-27(11-12-27)14-16-28)19-30(25)26(31)20-5-4-8-23(17-20)37(34,35)22-6-2-3-7-22;/h4-5,8-10,17-18,22,29H,2-3,6-7,11-16,19H2,1H3;1H |
| InChIKey | MDNIBCSXYOLVOA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |