C24H29N3O5S2 — CID 168726745
N-tert-butyl-3-[5-(methanesulfonamido)spiro[2H-indole-3,4'-cyclopentene]-1-carbonyl]benzenesulfonamide (PubChem CID 168726745) has the molecular formula C24H29N3O5S2 and a molecular weight of 503.65 g/mol. Its IUPAC name is N-tert-butyl-3-[5-(methanesulfonamido)spiro[2H-indole-3,4'-cyclopentene]-1-carbonyl]benzenesulfonamide.
| Compound Name | N-tert-butyl-3-[5-(methanesulfonamido)spiro[2H-indole-3,4'-cyclopentene]-1-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 168726745 |
| Molecular Formula | C24H29N3O5S2 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | N-tert-butyl-3-[5-(methanesulfonamido)spiro[2H-indole-3,4'-cyclopentene]-1-carbonyl]benzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1cccc(C(=O)N2CC3(CC=CC3)c3cc(NS(C)(=O)=O)ccc32)c1 |
| InChI | InChI=1S/C24H29N3O5S2/c1-23(2,3)26-34(31,32)19-9-7-8-17(14-19)22(28)27-16-24(12-5-6-13-24)20-15-18(10-11-21(20)27)25-33(4,29)30/h5-11,14-15,25-26H,12-13,16H2,1-4H3 |
| InChIKey | QVXYYCHDKDRLCV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|