C26H34N2O5S2 — CID 167493911
CID 167493911 (PubChem CID 167493911) has the molecular formula C26H34N2O5S2 and a molecular weight of 518.70 g/mol.
| Compound Name | CID 167493911 |
|---|---|
| PubChem CID | 167493911 |
| Molecular Formula | C26H34N2O5S2 |
| Molecular Weight | 518.70 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | — |
| SMILES | CC(C)S(=O)(=O)c1cccc(C(=O)N2CC3(CCC4(CC4)CC3)c3cc(NS(C)(=O)=O)ccc32)c1.[H][H] |
| InChI | InChI=1S/C26H32N2O5S2.H2/c1-18(2)35(32,33)21-6-4-5-19(15-21)24(29)28-17-26(13-11-25(9-10-25)12-14-26)22-16-20(7-8-23(22)28)27-34(3,30)31;/h4-8,15-16,18,27H,9-14,17H2,1-3H3;1H |
| InChIKey | GGLCWLWURVOBEG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.70 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |