C27H33N3O5S2 — CID 167493680
N-cyclohex-2-en-1-yl-3-[5-(methanesulfonamido)spiro[2H-indole-3,1'-cyclohexane]-1-carbonyl]benzenesulfonamide (PubChem CID 167493680) has the molecular formula C27H33N3O5S2 and a molecular weight of 543.71 g/mol. Its IUPAC name is N-cyclohex-2-en-1-yl-3-[5-(methanesulfonamido)spiro[2H-indole-3,1'-cyclohexane]-1-carbonyl]benzenesulfonamide.
| Compound Name | N-cyclohex-2-en-1-yl-3-[5-(methanesulfonamido)spiro[2H-indole-3,1'-cyclohexane]-1-carbonyl]benzenesulfonamide |
|---|---|
| PubChem CID | 167493680 |
| Molecular Formula | C27H33N3O5S2 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | N-cyclohex-2-en-1-yl-3-[5-(methanesulfonamido)spiro[2H-indole-3,1'-cyclohexane]-1-carbonyl]benzenesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)C1(CCCCC1)CN2C(=O)c1cccc(S(=O)(=O)NC2C=CCCC2)c1 |
| InChI | InChI=1S/C27H33N3O5S2/c1-36(32,33)28-22-13-14-25-24(18-22)27(15-6-3-7-16-27)19-30(25)26(31)20-9-8-12-23(17-20)37(34,35)29-21-10-4-2-5-11-21/h4,8-10,12-14,17-18,21,28-29H,2-3,5-7,11,15-16,19H2,1H3 |
| InChIKey | NWRQRODYIUGJTO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|