C26H33N3O6S2 — CID 170176354
CID 170176354 (PubChem CID 170176354) has the molecular formula C26H33N3O6S2 and a molecular weight of 547.70 g/mol.
| Compound Name | CID 170176354 |
|---|---|
| PubChem CID | 170176354 |
| Molecular Formula | C26H33N3O6S2 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | — |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)C1(CCC3(CC3)CC1)CN2C(=O)c1ccc(S(=O)(=O)N2CCCCC2)o1 |
| InChI | InChI=1S/C26H33N3O6S2/c1-36(31,32)27-19-5-6-21-20(17-19)26(13-11-25(9-10-25)12-14-26)18-29(21)24(30)22-7-8-23(35-22)37(33,34)28-15-3-2-4-16-28/h5-8,17,27H,2-4,9-16,18H2,1H3 |
| InChIKey | PKBZBHKEMXVHMS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |