C27H36N2O5S — CID 167493945
CID 167493945 (PubChem CID 167493945) has the molecular formula C27H36N2O5S and a molecular weight of 500.66 g/mol.
| Compound Name | CID 167493945 |
|---|---|
| PubChem CID | 167493945 |
| Molecular Formula | C27H36N2O5S |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | — |
| SMILES | CCS(=O)(=O)Nc1ccc2c(c1)C1(CCC3(CC3)CC1)CN2C(=O)c1ccc(C(O)C(C)(C)C)o1 |
| InChI | InChI=1S/C27H36N2O5S/c1-5-35(32,33)28-18-6-7-20-19(16-18)27(14-12-26(10-11-26)13-15-27)17-29(20)24(31)22-9-8-21(34-22)23(30)25(2,3)4/h6-9,16,23,28,30H,5,10-15,17H2,1-4H3 |
| InChIKey | GKJCYDMVPFKQSC-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |