C10H17NOS — CID 167522509
methane;O-(2,4,6-trimethylphenyl)sulfanylhydroxylamine (PubChem CID 167522509) has the molecular formula C10H17NOS and a molecular weight of 199.32 g/mol. Its IUPAC name is methane;O-(2,4,6-trimethylphenyl)sulfanylhydroxylamine.
| Compound Name | methane;O-(2,4,6-trimethylphenyl)sulfanylhydroxylamine |
|---|---|
| PubChem CID | 167522509 |
| Molecular Formula | C10H17NOS |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | methane;O-(2,4,6-trimethylphenyl)sulfanylhydroxylamine |
| SMILES | C.Cc1cc(C)c(SON)c(C)c1 |
| InChI | InChI=1S/C9H13NOS.CH4/c1-6-4-7(2)9(12-11-10)8(3)5-6;/h4-5H,10H2,1-3H3;1H4 |
| InChIKey | AOTZTBMIFGMNKG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|