C23H23F4NO2S — CID 167540289
1-[(4,4-dimethylcyclohexyl)methylsulfonyl]-4-(2-fluoro-4-isocyanophenyl)-2-(trifluoromethyl)benzene (PubChem CID 167540289) has the molecular formula C23H23F4NO2S and a molecular weight of 453.50 g/mol. Its IUPAC name is 1-[(4,4-dimethylcyclohexyl)methylsulfonyl]-4-(2-fluoro-4-isocyanophenyl)-2-(trifluoromethyl)benzene.
| Compound Name | 1-[(4,4-dimethylcyclohexyl)methylsulfonyl]-4-(2-fluoro-4-isocyanophenyl)-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 167540289 |
| Molecular Formula | C23H23F4NO2S |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 1-[(4,4-dimethylcyclohexyl)methylsulfonyl]-4-(2-fluoro-4-isocyanophenyl)-2-(trifluoromethyl)benzene |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(S(=O)(=O)CC3CCC(C)(C)CC3)c(C(F)(F)F)c2)c(F)c1 |
| InChI | InChI=1S/C23H23F4NO2S/c1-22(2)10-8-15(9-11-22)14-31(29,30)21-7-4-16(12-19(21)23(25,26)27)18-6-5-17(28-3)13-20(18)24/h4-7,12-13,15H,8-11,14H2,1-2H3 |
| InChIKey | MSBPZKSSEXZYTP-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|