C18H16Cl2O3 — CID 16758943
[3-(3,5-dichlorophenoxy)-6-phenyl-3,6-dihydro-2H-pyran-2-yl]methanol (PubChem CID 16758943) has the molecular formula C18H16Cl2O3 and a molecular weight of 351.23 g/mol. Its IUPAC name is [3-(3,5-dichlorophenoxy)-6-phenyl-3,6-dihydro-2H-pyran-2-yl]methanol.
| Compound Name | [3-(3,5-dichlorophenoxy)-6-phenyl-3,6-dihydro-2H-pyran-2-yl]methanol |
|---|---|
| PubChem CID | 16758943 |
| Molecular Formula | C18H16Cl2O3 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | [3-(3,5-dichlorophenoxy)-6-phenyl-3,6-dihydro-2H-pyran-2-yl]methanol |
| SMILES | OCC1OC(c2ccccc2)C=CC1Oc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H16Cl2O3/c19-13-8-14(20)10-15(9-13)22-17-7-6-16(23-18(17)11-21)12-4-2-1-3-5-12/h1-10,16-18,21H,11H2 |
| InChIKey | ULBNKSMBQPHNIA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|