C27H28N4O9S — CID 16759836
trimethyl (1S,9R,15S)-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-8-prop-2-enyl-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate (PubChem CID 16759836) has the molecular formula C27H28N4O9S and a molecular weight of 584.61 g/mol. Its IUPAC name is trimethyl (1S,9R,15S)-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-8-prop-2-enyl-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate.
| Compound Name | trimethyl (1S,9R,15S)-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-8-prop-2-enyl-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate |
|---|---|
| PubChem CID | 16759836 |
| Molecular Formula | C27H28N4O9S |
| Molecular Weight | 584.61 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | trimethyl (1S,9R,15S)-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-8-prop-2-enyl-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate |
| SMILES | C=CCN1c2ccccc2[C@]23C[C@@H](C(=O)OC)N(S(=O)(=O)c4c(C)noc4C)C2=NC(C(=O)OC)=C(C(=O)OC)[C@H]13 |
| InChI | InChI=1S/C27H28N4O9S/c1-7-12-30-17-11-9-8-10-16(17)27-13-18(23(32)37-4)31(41(35,36)21-14(2)29-40-15(21)3)26(27)28-20(25(34)39-6)19(22(27)30)24(33)38-5/h7-11,18,22H,1,12-13H2,2-6H3/t18-,22-,27-/m0/s1 |
| InChIKey | KNBFUHJNIYYTKO-PUIUQNQWSA-N |
| XLogP | 1.55 |
| TPSA | 157.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.61 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|