C27H27ClFNO4 — CID 167614338
(E,2R)-2-benzyl-6-(3-chloro-5-fluorophenyl)-4-oxo-N-[(2S)-1-oxo-3-[(1S)-2-oxocyclopentyl]propan-2-yl]hex-5-enamide (PubChem CID 167614338) has the molecular formula C27H27ClFNO4 and a molecular weight of 483.97 g/mol. Its IUPAC name is (E,2R)-2-benzyl-6-(3-chloro-5-fluorophenyl)-4-oxo-N-[(2S)-1-oxo-3-[(1S)-2-oxocyclopentyl]propan-2-yl]hex-5-enamide.
| Compound Name | (E,2R)-2-benzyl-6-(3-chloro-5-fluorophenyl)-4-oxo-N-[(2S)-1-oxo-3-[(1S)-2-oxocyclopentyl]propan-2-yl]hex-5-enamide |
|---|---|
| PubChem CID | 167614338 |
| Molecular Formula | C27H27ClFNO4 |
| Molecular Weight | 483.97 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | (E,2R)-2-benzyl-6-(3-chloro-5-fluorophenyl)-4-oxo-N-[(2S)-1-oxo-3-[(1S)-2-oxocyclopentyl]propan-2-yl]hex-5-enamide |
| SMILES | O=C[C@H](C[C@@H]1CCCC1=O)NC(=O)[C@@H](CC(=O)/C=C/c1cc(F)cc(Cl)c1)Cc1ccccc1 |
| InChI | InChI=1S/C27H27ClFNO4/c28-22-12-19(13-23(29)16-22)9-10-25(32)15-21(11-18-5-2-1-3-6-18)27(34)30-24(17-31)14-20-7-4-8-26(20)33/h1-3,5-6,9-10,12-13,16-17,20-21,24H,4,7-8,11,14-15H2,(H,30,34)/b10-9+/t20-,21+,24-/m0/s1 |
| InChIKey | MZWWVZAQCHRXSY-MOAFTDFKSA-N |
| XLogP | 4.75 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.97 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|