C43H43FN6O5 — CID 167679559
2-(2,4-dioxocyclohexyl)-5-[3-[2-[3-fluoro-5-(5-propan-2-ylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]-2,7-diazaspiro[3.5]nonan-7-yl]propoxy]isoindole-1,3-dione (PubChem CID 167679559) has the molecular formula C43H43FN6O5 and a molecular weight of 742.85 g/mol. Its IUPAC name is 2-(2,4-dioxocyclohexyl)-5-[3-[2-[3-fluoro-5-(5-propan-2-ylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]-2,7-diazaspiro[3.5]nonan-7-yl]propoxy]isoindole-1,3-dione.
| Compound Name | 2-(2,4-dioxocyclohexyl)-5-[3-[2-[3-fluoro-5-(5-propan-2-ylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]-2,7-diazaspiro[3.5]nonan-7-yl]propoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167679559 |
| Molecular Formula | C43H43FN6O5 |
| Molecular Weight | 742.85 g/mol |
| Exact Mass | 742.33 |
| IUPAC Name | 2-(2,4-dioxocyclohexyl)-5-[3-[2-[3-fluoro-5-(5-propan-2-ylpyrido[4,3-b]indol-7-yl)-2-pyridinyl]-2,7-diazaspiro[3.5]nonan-7-yl]propoxy]isoindole-1,3-dione |
| SMILES | CC(C)n1c2ccncc2c2ccc(-c3cnc(N4CC5(CCN(CCCOc6ccc7c(c6)C(=O)N(C6CCC(=O)CC6=O)C7=O)CC5)C4)c(F)c3)cc21 |
| InChI | InChI=1S/C43H43FN6O5/c1-26(2)49-36-10-13-45-23-34(36)31-7-4-27(19-38(31)49)28-18-35(44)40(46-22-28)48-24-43(25-48)11-15-47(16-12-43)14-3-17-55-30-6-8-32-33(21-30)42(54)50(41(32)53)37-9-5-29(51)20-39(37)52/h4,6-8,10,13,18-19,21-23,26,37H,3,5,9,11-12,14-17,20,24-25H2,1-2H3 |
| InChIKey | VIALBDWCTDIKMS-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 117.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.85 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|