C13H18F4O2S — CID 167691326
1-(1,1,2,2-tetrafluoro-2-methylsulfonylethyl)adamantane (PubChem CID 167691326) has the molecular formula C13H18F4O2S and a molecular weight of 314.34 g/mol. Its IUPAC name is 1-(1,1,2,2-tetrafluoro-2-methylsulfonylethyl)adamantane.
| Compound Name | 1-(1,1,2,2-tetrafluoro-2-methylsulfonylethyl)adamantane |
|---|---|
| PubChem CID | 167691326 |
| Molecular Formula | C13H18F4O2S |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 1-(1,1,2,2-tetrafluoro-2-methylsulfonylethyl)adamantane |
| SMILES | CS(=O)(=O)C(F)(F)C(F)(F)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C13H18F4O2S/c1-20(18,19)13(16,17)12(14,15)11-5-8-2-9(6-11)4-10(3-8)7-11/h8-10H,2-7H2,1H3 |
| InChIKey | KJIAITMXSSEPKI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|