C46H58N3O2+ — CID 167693363
6-[(2E)-2-[(2E,4E)-5-[1-butyl-5-(dimethylamino)-3,3-dimethylindol-1-ium-2-yl]penta-2,4-dienylidene]-3,3,9,9-tetramethylindeno[1,2-f]indol-1-yl]hexanoic acid (PubChem CID 167693363) has the molecular formula C46H58N3O2+ and a molecular weight of 684.99 g/mol. Its IUPAC name is 6-[(2E)-2-[(2E,4E)-5-[1-butyl-5-(dimethylamino)-3,3-dimethylindol-1-ium-2-yl]penta-2,4-dienylidene]-3,3,9,9-tetramethylindeno[1,2-f]indol-1-yl]hexanoic acid.
| Compound Name | 6-[(2E)-2-[(2E,4E)-5-[1-butyl-5-(dimethylamino)-3,3-dimethylindol-1-ium-2-yl]penta-2,4-dienylidene]-3,3,9,9-tetramethylindeno[1,2-f]indol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 167693363 |
| Molecular Formula | C46H58N3O2+ |
| Molecular Weight | 684.99 g/mol |
| Exact Mass | 684.45 |
| IUPAC Name | 6-[(2E)-2-[(2E,4E)-5-[1-butyl-5-(dimethylamino)-3,3-dimethylindol-1-ium-2-yl]penta-2,4-dienylidene]-3,3,9,9-tetramethylindeno[1,2-f]indol-1-yl]hexanoic acid |
| SMILES | CCCC[N+]1=C(/C=C/C=C/C=C2/N(CCCCCC(=O)O)c3cc4c(cc3C2(C)C)-c2ccccc2C4(C)C)C(C)(C)c2cc(N(C)C)ccc21 |
| InChI | InChI=1S/C46H57N3O2/c1-10-11-27-48-39-26-25-32(47(8)9)29-37(39)45(4,5)41(48)22-14-12-15-23-42-46(6,7)38-30-34-33-20-17-18-21-35(33)44(2,3)36(34)31-40(38)49(42)28-19-13-16-24-43(50)51/h12,14-15,17-18,20-23,25-26,29-31H,10-11,13,16,19,24,27-28H2,1-9H3/p+1 |
| InChIKey | ZWICDACFRZORDB-UHFFFAOYSA-O |
| XLogP | 10.67 |
| TPSA | 46.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.99 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|