C12H19N3O5S2 — CID 167745076
8-[[5-(methylsulfamoyl)-1,3-thiazol-2-yl]amino]-8-oxooctanoic acid (PubChem CID 167745076) has the molecular formula C12H19N3O5S2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 8-[[5-(methylsulfamoyl)-1,3-thiazol-2-yl]amino]-8-oxooctanoic acid.
| Compound Name | 8-[[5-(methylsulfamoyl)-1,3-thiazol-2-yl]amino]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 167745076 |
| Molecular Formula | C12H19N3O5S2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 8-[[5-(methylsulfamoyl)-1,3-thiazol-2-yl]amino]-8-oxooctanoic acid |
| SMILES | CNS(=O)(=O)c1cnc(NC(=O)CCCCCCC(=O)O)s1 |
| InChI | InChI=1S/C12H19N3O5S2/c1-13-22(19,20)11-8-14-12(21-11)15-9(16)6-4-2-3-5-7-10(17)18/h8,13H,2-7H2,1H3,(H,17,18)(H,14,15,16) |
| InChIKey | NYHZKOWVDKEMDW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|