C16H12ClN3O3S2 — CID 167805479
4-[(2-chloro-4-phenyl-1,3-thiazol-5-yl)sulfonylamino]benzamide (PubChem CID 167805479) has the molecular formula C16H12ClN3O3S2 and a molecular weight of 393.88 g/mol. Its IUPAC name is 4-[(2-chloro-4-phenyl-1,3-thiazol-5-yl)sulfonylamino]benzamide.
| Compound Name | 4-[(2-chloro-4-phenyl-1,3-thiazol-5-yl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 167805479 |
| Molecular Formula | C16H12ClN3O3S2 |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | 4-[(2-chloro-4-phenyl-1,3-thiazol-5-yl)sulfonylamino]benzamide |
| SMILES | NC(=O)c1ccc(NS(=O)(=O)c2sc(Cl)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H12ClN3O3S2/c17-16-19-13(10-4-2-1-3-5-10)15(24-16)25(22,23)20-12-8-6-11(7-9-12)14(18)21/h1-9,20H,(H2,18,21) |
| InChIKey | WYTNVUVVDPIIOG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |