C23H20N6O2S — CID 167828732
N-[3-[3-(3-methyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-1,2,4-oxadiazol-5-yl]phenyl]-4-thiophen-2-ylbutanamide (PubChem CID 167828732) has the molecular formula C23H20N6O2S and a molecular weight of 444.52 g/mol. Its IUPAC name is N-[3-[3-(3-methyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-1,2,4-oxadiazol-5-yl]phenyl]-4-thiophen-2-ylbutanamide.
| Compound Name | N-[3-[3-(3-methyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-1,2,4-oxadiazol-5-yl]phenyl]-4-thiophen-2-ylbutanamide |
|---|---|
| PubChem CID | 167828732 |
| Molecular Formula | C23H20N6O2S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | N-[3-[3-(3-methyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-1,2,4-oxadiazol-5-yl]phenyl]-4-thiophen-2-ylbutanamide |
| SMILES | Cc1nnc2ccc(-c3noc(-c4cccc(NC(=O)CCCc5cccs5)c4)n3)cn12 |
| InChI | InChI=1S/C23H20N6O2S/c1-15-26-27-20-11-10-17(14-29(15)20)22-25-23(31-28-22)16-5-2-6-18(13-16)24-21(30)9-3-7-19-8-4-12-32-19/h2,4-6,8,10-14H,3,7,9H2,1H3,(H,24,30) |
| InChIKey | QZZCLPAWPWWRSV-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |