C9H7ClFN3OS — CID 167875738
2-chloro-2-fluoro-N-(5-methyl-2,1,3-benzothiadiazol-4-yl)acetamide (PubChem CID 167875738) has the molecular formula C9H7ClFN3OS and a molecular weight of 259.69 g/mol. Its IUPAC name is 2-chloro-2-fluoro-N-(5-methyl-2,1,3-benzothiadiazol-4-yl)acetamide.
| Compound Name | 2-chloro-2-fluoro-N-(5-methyl-2,1,3-benzothiadiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 167875738 |
| Molecular Formula | C9H7ClFN3OS |
| Molecular Weight | 259.69 g/mol |
| Exact Mass | 259.00 |
| IUPAC Name | 2-chloro-2-fluoro-N-(5-methyl-2,1,3-benzothiadiazol-4-yl)acetamide |
| SMILES | Cc1ccc2nsnc2c1NC(=O)C(F)Cl |
| InChI | InChI=1S/C9H7ClFN3OS/c1-4-2-3-5-7(14-16-13-5)6(4)12-9(15)8(10)11/h2-3,8H,1H3,(H,12,15) |
| InChIKey | DCLQGKGSWBKVQF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.69 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|