C11H10ClF2N7 — CID 167883406
2-chloro-N-[[4-(difluoromethyl)-1-methylpyrazol-3-yl]methyl]-7H-purin-6-amine (PubChem CID 167883406) has the molecular formula C11H10ClF2N7 and a molecular weight of 313.70 g/mol. Its IUPAC name is 2-chloro-N-[[4-(difluoromethyl)-1-methylpyrazol-3-yl]methyl]-7H-purin-6-amine.
| Compound Name | 2-chloro-N-[[4-(difluoromethyl)-1-methylpyrazol-3-yl]methyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 167883406 |
| Molecular Formula | C11H10ClF2N7 |
| Molecular Weight | 313.70 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-chloro-N-[[4-(difluoromethyl)-1-methylpyrazol-3-yl]methyl]-7H-purin-6-amine |
| SMILES | Cn1cc(C(F)F)c(CNc2nc(Cl)nc3nc[nH]c23)n1 |
| InChI | InChI=1S/C11H10ClF2N7/c1-21-3-5(8(13)14)6(20-21)2-15-9-7-10(17-4-16-7)19-11(12)18-9/h3-4,8H,2H2,1H3,(H2,15,16,17,18,19) |
| InChIKey | RLRBDDHYDHDMQC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.70 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |