C15H19N3O3S — CID 167890240
3,5-dimethyl-4-(4-piperazin-1-ylsulfonylphenyl)-1,2-oxazole (PubChem CID 167890240) has the molecular formula C15H19N3O3S and a molecular weight of 321.40 g/mol. Its IUPAC name is 3,5-dimethyl-4-(4-piperazin-1-ylsulfonylphenyl)-1,2-oxazole.
| Compound Name | 3,5-dimethyl-4-(4-piperazin-1-ylsulfonylphenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 167890240 |
| Molecular Formula | C15H19N3O3S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 3,5-dimethyl-4-(4-piperazin-1-ylsulfonylphenyl)-1,2-oxazole |
| SMILES | Cc1noc(C)c1-c1ccc(S(=O)(=O)N2CCNCC2)cc1 |
| InChI | InChI=1S/C15H19N3O3S/c1-11-15(12(2)21-17-11)13-3-5-14(6-4-13)22(19,20)18-9-7-16-8-10-18/h3-6,16H,7-10H2,1-2H3 |
| InChIKey | XVPACFKDLQYFLH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |