C24H17BrClN3O5S2 — CID 167920689
1-(2-bromophenyl)ethyl 4-chloro-2-[[2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetyl]amino]benzoate (PubChem CID 167920689) has the molecular formula C24H17BrClN3O5S2 and a molecular weight of 606.91 g/mol. Its IUPAC name is 1-(2-bromophenyl)ethyl 4-chloro-2-[[2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetyl]amino]benzoate.
| Compound Name | 1-(2-bromophenyl)ethyl 4-chloro-2-[[2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 167920689 |
| Molecular Formula | C24H17BrClN3O5S2 |
| Molecular Weight | 606.91 g/mol |
| Exact Mass | 604.95 |
| IUPAC Name | 1-(2-bromophenyl)ethyl 4-chloro-2-[[2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetyl]amino]benzoate |
| SMILES | CC(OC(=O)c1ccc(Cl)cc1NC(=O)CSc1nc2ccc([N+](=O)[O-])cc2s1)c1ccccc1Br |
| InChI | InChI=1S/C24H17BrClN3O5S2/c1-13(16-4-2-3-5-18(16)25)34-23(31)17-8-6-14(26)10-20(17)27-22(30)12-35-24-28-19-9-7-15(29(32)33)11-21(19)36-24/h2-11,13H,12H2,1H3,(H,27,30) |
| InChIKey | GTUTYWVZYUVUNF-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.91 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|