C13H16N4O6S — CID 168535306
2-[4-[(carbamothioylhydrazinylidene)methyl]-2-ethoxy-6-nitrophenoxy]propanoic acid (PubChem CID 168535306) has the molecular formula C13H16N4O6S and a molecular weight of 356.36 g/mol. Its IUPAC name is 2-[4-[(carbamothioylhydrazinylidene)methyl]-2-ethoxy-6-nitrophenoxy]propanoic acid.
| Compound Name | 2-[4-[(carbamothioylhydrazinylidene)methyl]-2-ethoxy-6-nitrophenoxy]propanoic acid |
|---|---|
| PubChem CID | 168535306 |
| Molecular Formula | C13H16N4O6S |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 2-[4-[(carbamothioylhydrazinylidene)methyl]-2-ethoxy-6-nitrophenoxy]propanoic acid |
| SMILES | CCOc1cc(C=NNC(N)=S)cc([N+](=O)[O-])c1OC(C)C(=O)O |
| InChI | InChI=1S/C13H16N4O6S/c1-3-22-10-5-8(6-15-16-13(14)24)4-9(17(20)21)11(10)23-7(2)12(18)19/h4-7H,3H2,1-2H3,(H,18,19)(H3,14,16,24) |
| InChIKey | BSSBLDMJBKCYKB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 149.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|