C12H13F6NO3 — CID 168593889
3-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]propane-1,2-diol (PubChem CID 168593889) has the molecular formula C12H13F6NO3 and a molecular weight of 333.23 g/mol. Its IUPAC name is 3-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]propane-1,2-diol.
| Compound Name | 3-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]propane-1,2-diol |
|---|---|
| PubChem CID | 168593889 |
| Molecular Formula | C12H13F6NO3 |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 3-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]propane-1,2-diol |
| SMILES | OCC(O)CNc1cccc(C(O)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F6NO3/c13-11(14,15)10(22,12(16,17)18)7-2-1-3-8(4-7)19-5-9(21)6-20/h1-4,9,19-22H,5-6H2 |
| InChIKey | DMNBDXQKSVBYGT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |