About tert-butyl 4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-3-bromoindole-1-carboxylate
tert-butyl 4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-3-bromoindole-1-carboxylate (PubChem CID 168627345) has the molecular formula C17H18BrN5O2S
and a molecular weight of 436.34 g/mol. Its IUPAC name is tert-butyl 4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-3-bromoindole-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-3-bromoindole-1-carboxylate |
| PubChem CID | 168627345 |
| Molecular Formula | C17H18BrN5O2S |
| Molecular Weight | 436.34 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | tert-butyl 4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-3-bromoindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(Br)c2c(C=NNc3nc(N)cs3)cccc21 |
| InChI | InChI=1S/C17H18BrN5O2S/c1-17(2,3)25-16(24)23-8-11(18)14-10(5-4-6-12(14)23)7-20-22-15-21-13(19)9-26-15/h4-9H,19H2,1-3H3,(H,21,22) |
| InChIKey | ADCYNYJIIPSMCB-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.34 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-3-bromoindole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-3-bromoindole-1-carboxylate?
The IUPAC name of tert-butyl 4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-3-bromoindole-1-carboxylate (CID 168627345) is tert-butyl 4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-3-bromoindole-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-3-bromoindole-1-carboxylate?
The canonical SMILES for tert-butyl 4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-3-bromoindole-1-carboxylate is CC(C)(C)OC(=O)n1cc(Br)c2c(C=NNc3nc(N)cs3)cccc21.
What is the InChIKey of tert-butyl 4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-3-bromoindole-1-carboxylate?
The InChIKey is ADCYNYJIIPSMCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18BrN5O2S/c1-17(2,3)25-16(24)23-8-11(18)14-10(5-4-6-12(14)23)7-20-22-15-21-13(19)9-26-15/h4-9H,19H2,1-3H3,(H,21,22).
What are the key properties of tert-butyl 4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-3-bromoindole-1-carboxylate?
tert-butyl 4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-3-bromoindole-1-carboxylate has a molecular weight of 436.34 g/mol, XLogP of 4.67, 3 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[[(4-amino-1,3-thiazol-2-yl)hydrazinylidene]methyl]-3-bromoindole-1-carboxylate is sourced from PubChem (CID 168627345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).