C25H20F6N2O6 — CID 168650425
dimethyl 1-[5-[2-(3-amino-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]azepine-2,3-dicarboxylate (PubChem CID 168650425) has the molecular formula C25H20F6N2O6 and a molecular weight of 558.43 g/mol. Its IUPAC name is dimethyl 1-[5-[2-(3-amino-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]azepine-2,3-dicarboxylate.
| Compound Name | dimethyl 1-[5-[2-(3-amino-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]azepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 168650425 |
| Molecular Formula | C25H20F6N2O6 |
| Molecular Weight | 558.43 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | dimethyl 1-[5-[2-(3-amino-4-hydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-hydroxyphenyl]azepine-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N(c2cc(C(c3ccc(O)c(N)c3)(C(F)(F)F)C(F)(F)F)ccc2O)C=CC=C1 |
| InChI | InChI=1S/C25H20F6N2O6/c1-38-21(36)15-5-3-4-10-33(20(15)22(37)39-2)17-12-14(7-9-19(17)35)23(24(26,27)28,25(29,30)31)13-6-8-18(34)16(32)11-13/h3-12,34-35H,32H2,1-2H3 |
| InChIKey | DRCWEQLELTYGLG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.43 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|