C12H13N5O2S3 — CID 16867848
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-3-yl)acetamide (PubChem CID 16867848) has the molecular formula C12H13N5O2S3 and a molecular weight of 355.47 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-3-yl)acetamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 16867848 |
| Molecular Formula | C12H13N5O2S3 |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-3-yl)acetamide |
| SMILES | CCSc1nnc(NC(=O)CC2CSc3nccc(=O)n32)s1 |
| InChI | InChI=1S/C12H13N5O2S3/c1-2-20-12-16-15-10(22-12)14-8(18)5-7-6-21-11-13-4-3-9(19)17(7)11/h3-4,7H,2,5-6H2,1H3,(H,14,15,18) |
| InChIKey | WANMHVBCKUZMNY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|