C49H45Cl4N3O5 — CID 168742180
9H-fluoren-9-ylmethyl N-[3-[4-(6-aminohexoxy)phenyl]-1-[(3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-4-oxopiperidin-1-yl]-1-oxopropan-2-yl]carbamate (PubChem CID 168742180) has the molecular formula C49H45Cl4N3O5 and a molecular weight of 897.73 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-[4-(6-aminohexoxy)phenyl]-1-[(3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-4-oxopiperidin-1-yl]-1-oxopropan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-[4-(6-aminohexoxy)phenyl]-1-[(3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-4-oxopiperidin-1-yl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 168742180 |
| Molecular Formula | C49H45Cl4N3O5 |
| Molecular Weight | 897.73 g/mol |
| Exact Mass | 895.21 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-[4-(6-aminohexoxy)phenyl]-1-[(3E,5E)-3,5-bis[(3,4-dichlorophenyl)methylidene]-4-oxopiperidin-1-yl]-1-oxopropan-2-yl]carbamate |
| SMILES | NCCCCCCOc1ccc(CC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)N2C/C(=C\c3ccc(Cl)c(Cl)c3)C(=O)/C(=C/c3ccc(Cl)c(Cl)c3)C2)cc1 |
| InChI | InChI=1S/C49H45Cl4N3O5/c50-42-19-15-32(25-44(42)52)23-34-28-56(29-35(47(34)57)24-33-16-20-43(51)45(53)26-33)48(58)46(27-31-13-17-36(18-14-31)60-22-8-2-1-7-21-54)55-49(59)61-30-41-39-11-5-3-9-37(39)38-10-4-6-12-40(38)41/h3-6,9-20,23-26,41,46H,1-2,7-8,21-22,27-30,54H2,(H,55,59)/b34-23+,35-24+ |
| InChIKey | MLNTTZRHKLAYFR-OBZMNYCPSA-N |
| XLogP | 11.23 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.73 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|