C29H37NO4S2 — CID 168824163
7-[2-[2-(2-ethenoxyethylsulfanyl)ethylsulfanyl]ethoxy]-3-(2-ethyl-4-pentylphenyl)pyrano[3,2-c]pyridin-2-one (PubChem CID 168824163) has the molecular formula C29H37NO4S2 and a molecular weight of 527.75 g/mol. Its IUPAC name is 7-[2-[2-(2-ethenoxyethylsulfanyl)ethylsulfanyl]ethoxy]-3-(2-ethyl-4-pentylphenyl)pyrano[3,2-c]pyridin-2-one.
| Compound Name | 7-[2-[2-(2-ethenoxyethylsulfanyl)ethylsulfanyl]ethoxy]-3-(2-ethyl-4-pentylphenyl)pyrano[3,2-c]pyridin-2-one |
|---|---|
| PubChem CID | 168824163 |
| Molecular Formula | C29H37NO4S2 |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | 7-[2-[2-(2-ethenoxyethylsulfanyl)ethylsulfanyl]ethoxy]-3-(2-ethyl-4-pentylphenyl)pyrano[3,2-c]pyridin-2-one |
| SMILES | C=COCCSCCSCCOc1cc2oc(=O)c(-c3ccc(CCCCC)cc3CC)cc2cn1 |
| InChI | InChI=1S/C29H37NO4S2/c1-4-7-8-9-22-10-11-25(23(5-2)18-22)26-19-24-21-30-28(20-27(24)34-29(26)31)33-13-15-36-17-16-35-14-12-32-6-3/h6,10-11,18-21H,3-5,7-9,12-17H2,1-2H3 |
| InChIKey | NDGQPLAYAYXYCF-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|