C12H11F2N5O4 — CID 168841210
(2R,3R,4R,5R)-3-fluoro-2-[5-fluoro-4-(hydroxyamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-hydroxy-5-(hydroxymethyl)oxolane-2-carbonitrile (PubChem CID 168841210) has the molecular formula C12H11F2N5O4 and a molecular weight of 327.25 g/mol. Its IUPAC name is (2R,3R,4R,5R)-3-fluoro-2-[5-fluoro-4-(hydroxyamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-hydroxy-5-(hydroxymethyl)oxolane-2-carbonitrile.
| Compound Name | (2R,3R,4R,5R)-3-fluoro-2-[5-fluoro-4-(hydroxyamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-hydroxy-5-(hydroxymethyl)oxolane-2-carbonitrile |
|---|---|
| PubChem CID | 168841210 |
| Molecular Formula | C12H11F2N5O4 |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | (2R,3R,4R,5R)-3-fluoro-2-[5-fluoro-4-(hydroxyamino)pyrrolo[2,1-f][1,2,4]triazin-7-yl]-4-hydroxy-5-(hydroxymethyl)oxolane-2-carbonitrile |
| SMILES | N#C[C@@]1(c2cc(F)c3c(NO)ncnn23)O[C@H](CO)[C@@H](O)[C@H]1F |
| InChI | InChI=1S/C12H11F2N5O4/c13-5-1-7(19-8(5)11(18-22)16-4-17-19)12(3-15)10(14)9(21)6(2-20)23-12/h1,4,6,9-10,20-22H,2H2,(H,16,17,18)/t6-,9-,10-,12+/m1/s1 |
| InChIKey | APUIISDHLUFPEQ-CWLXEDRGSA-N |
| XLogP | -0.52 |
| TPSA | 135.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|