C11H14N4O3S — CID 168861197
2-(1,1-dioxothian-4-yl)-7-methyl-9H-purin-8-one (PubChem CID 168861197) has the molecular formula C11H14N4O3S and a molecular weight of 282.32 g/mol. Its IUPAC name is 2-(1,1-dioxothian-4-yl)-7-methyl-9H-purin-8-one.
| Compound Name | 2-(1,1-dioxothian-4-yl)-7-methyl-9H-purin-8-one |
|---|---|
| PubChem CID | 168861197 |
| Molecular Formula | C11H14N4O3S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-(1,1-dioxothian-4-yl)-7-methyl-9H-purin-8-one |
| SMILES | Cn1c(=O)[nH]c2nc(C3CCS(=O)(=O)CC3)ncc21 |
| InChI | InChI=1S/C11H14N4O3S/c1-15-8-6-12-9(13-10(8)14-11(15)16)7-2-4-19(17,18)5-3-7/h6-7H,2-5H2,1H3,(H,12,13,14,16) |
| InChIKey | GKVCTIHGFORWSW-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |