C11H16FmNO4- — CID 168915673
fermium;(E)-3-hydroxy-2-(oxomethylamino)-4-[(Z)-prop-1-enyl]hept-4-enoic acid (PubChem CID 168915673) has the molecular formula C11H16FmNO4- and a molecular weight of 483.25 g/mol. Its IUPAC name is fermium;(E)-3-hydroxy-2-(oxomethylamino)-4-[(Z)-prop-1-enyl]hept-4-enoic acid.
| Compound Name | fermium;(E)-3-hydroxy-2-(oxomethylamino)-4-[(Z)-prop-1-enyl]hept-4-enoic acid |
|---|---|
| PubChem CID | 168915673 |
| Molecular Formula | C11H16FmNO4- |
| Molecular Weight | 483.25 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | fermium;(E)-3-hydroxy-2-(oxomethylamino)-4-[(Z)-prop-1-enyl]hept-4-enoic acid |
| SMILES | C/C=C\C(=C/CC)C(O)C(N[C-]=O)C(=O)O.[Fm] |
| InChI | InChI=1S/C11H16NO4.Fm/c1-3-5-8(6-4-2)10(14)9(11(15)16)12-7-13;/h3,5-6,9-10,14H,4H2,1-2H3,(H,12,13)(H,15,16);/q-1;/b5-3-,8-6+; |
| InChIKey | DJYCMMKJYWMRKQ-MQASBHRKSA-N |
| XLogP | 0.37 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|